C4H4ClN6P — CID 54540408
[5-(5-chloro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-yl]phosphane (PubChem CID 54540408) has the molecular formula C4H4ClN6P and a molecular weight of 202.55 g/mol. Its IUPAC name is [5-(5-chloro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-yl]phosphane.
| Compound Name | [5-(5-chloro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-yl]phosphane |
|---|---|
| PubChem CID | 54540408 |
| Molecular Formula | C4H4ClN6P |
| Molecular Weight | 202.55 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | [5-(5-chloro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-yl]phosphane |
| SMILES | Pc1n[nH]c(-c2n[nH]c(Cl)n2)n1 |
| InChI | InChI=1S/C4H4ClN6P/c5-3-6-1(8-10-3)2-7-4(12)11-9-2/h12H2,(H,6,8,10)(H,7,9,11) |
| InChIKey | ZCTXVCONPUHOEP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|