C24H50O8 — CID 54540650
1,1,2,5-tetrakis(tert-butylperoxy)-2,5-dimethylhexane (PubChem CID 54540650) has the molecular formula C24H50O8 and a molecular weight of 466.66 g/mol. Its IUPAC name is 1,1,2,5-tetrakis(tert-butylperoxy)-2,5-dimethylhexane.
| Compound Name | 1,1,2,5-tetrakis(tert-butylperoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 54540650 |
| Molecular Formula | C24H50O8 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 1,1,2,5-tetrakis(tert-butylperoxy)-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOC(OOC(C)(C)C)C(C)(CCC(C)(C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C24H50O8/c1-19(2,3)27-25-18(26-28-20(4,5)6)24(15,32-30-22(10,11)12)17-16-23(13,14)31-29-21(7,8)9/h18H,16-17H2,1-15H3 |
| InChIKey | ZCYDUEQJDPXWNU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|