About methyl 2,2-bis(sulfanyl)acetate
methyl 2,2-bis(sulfanyl)acetate (PubChem CID 54540912) has the molecular formula C3H6O2S2
and a molecular weight of 138.21 g/mol. Its IUPAC name is methyl 2,2-bis(sulfanyl)acetate.
Molecular Properties
| Compound Name | methyl 2,2-bis(sulfanyl)acetate |
| PubChem CID | 54540912 |
| Molecular Formula | C3H6O2S2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 137.98 |
| IUPAC Name | methyl 2,2-bis(sulfanyl)acetate |
| SMILES | COC(=O)C(S)S |
| InChI | InChI=1S/C3H6O2S2/c1-5-2(4)3(6)7/h3,6-7H,1H3 |
| InChIKey | ZDDGKXNSRNLVEB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,2-bis(sulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-bis(sulfanyl)acetate?
The IUPAC name of methyl 2,2-bis(sulfanyl)acetate (CID 54540912) is methyl 2,2-bis(sulfanyl)acetate.
What is the SMILES notation for methyl 2,2-bis(sulfanyl)acetate?
The canonical SMILES for methyl 2,2-bis(sulfanyl)acetate is COC(=O)C(S)S.
What is the InChIKey of methyl 2,2-bis(sulfanyl)acetate?
The InChIKey is ZDDGKXNSRNLVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S2/c1-5-2(4)3(6)7/h3,6-7H,1H3.
What are the key properties of methyl 2,2-bis(sulfanyl)acetate?
methyl 2,2-bis(sulfanyl)acetate has a molecular weight of 138.21 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-bis(sulfanyl)acetate is sourced from PubChem (CID 54540912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).