C6H12N2 — CID 54540988
(1S,2S)-cyclohex-4-ene-1,2-diamine (PubChem CID 54540988) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1S,2S)-cyclohex-4-ene-1,2-diamine.
| Compound Name | (1S,2S)-cyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 54540988 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1S,2S)-cyclohex-4-ene-1,2-diamine |
| SMILES | N[C@H]1CC=CC[C@@H]1N |
| InChI | InChI=1S/C6H12N2/c7-5-3-1-2-4-6(5)8/h1-2,5-6H,3-4,7-8H2/t5-,6-/m0/s1 |
| InChIKey | ZDENNVQHCXLZDN-WDSKDSINSA-N |
| XLogP | -0.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|