About 11-chloro-10H-indolo[3,2-b]quinoline
11-chloro-10H-indolo[3,2-b]quinoline (PubChem CID 5454187) has the molecular formula C15H9ClN2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 11-chloro-10H-indolo[3,2-b]quinoline.
Molecular Properties
| Compound Name | 11-chloro-10H-indolo[3,2-b]quinoline |
| PubChem CID | 5454187 |
| Molecular Formula | C15H9ClN2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 11-chloro-10H-indolo[3,2-b]quinoline |
| SMILES | Clc1c2ccccc2nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C15H9ClN2/c16-13-9-5-1-3-7-11(9)17-14-10-6-2-4-8-12(10)18-15(13)14/h1-8,18H |
| InChIKey | DUMZYVAZBKDIQG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-chloro-10H-indolo[3,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chloro-10H-indolo[3,2-b]quinoline?
The IUPAC name of 11-chloro-10H-indolo[3,2-b]quinoline (CID 5454187) is 11-chloro-10H-indolo[3,2-b]quinoline.
What is the SMILES notation for 11-chloro-10H-indolo[3,2-b]quinoline?
The canonical SMILES for 11-chloro-10H-indolo[3,2-b]quinoline is Clc1c2ccccc2nc2c1[nH]c1ccccc12.
What is the InChIKey of 11-chloro-10H-indolo[3,2-b]quinoline?
The InChIKey is DUMZYVAZBKDIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN2/c16-13-9-5-1-3-7-11(9)17-14-10-6-2-4-8-12(10)18-15(13)14/h1-8,18H.
What are the key properties of 11-chloro-10H-indolo[3,2-b]quinoline?
11-chloro-10H-indolo[3,2-b]quinoline has a molecular weight of 252.70 g/mol, XLogP of 4.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chloro-10H-indolo[3,2-b]quinoline is sourced from PubChem (CID 5454187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).