About 1-prop-1-enylanthracene
1-prop-1-enylanthracene (PubChem CID 54542061) has the molecular formula C17H14
and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-prop-1-enylanthracene.
Molecular Properties
| Compound Name | 1-prop-1-enylanthracene |
| PubChem CID | 54542061 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-prop-1-enylanthracene |
| SMILES | CC=Cc1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C17H14/c1-2-6-13-9-5-10-16-11-14-7-3-4-8-15(14)12-17(13)16/h2-12H,1H3 |
| InChIKey | ZDXIJWYBZYCIOU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-1-enylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-1-enylanthracene?
The IUPAC name of 1-prop-1-enylanthracene (CID 54542061) is 1-prop-1-enylanthracene.
What is the SMILES notation for 1-prop-1-enylanthracene?
The canonical SMILES for 1-prop-1-enylanthracene is CC=Cc1cccc2cc3ccccc3cc12.
What is the InChIKey of 1-prop-1-enylanthracene?
The InChIKey is ZDXIJWYBZYCIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14/c1-2-6-13-9-5-10-16-11-14-7-3-4-8-15(14)12-17(13)16/h2-12H,1H3.
What are the key properties of 1-prop-1-enylanthracene?
1-prop-1-enylanthracene has a molecular weight of 218.30 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-1-enylanthracene is sourced from PubChem (CID 54542061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).