C48H44Cl4N2O4 — CID 54542072
4,5,6,7-tetrachloro-3,3-bis[2-(4-methoxy-2-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 54542072) has the molecular formula C48H44Cl4N2O4 and a molecular weight of 854.70 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[2-(4-methoxy-2-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[2-(4-methoxy-2-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54542072 |
| Molecular Formula | C48H44Cl4N2O4 |
| Molecular Weight | 854.70 g/mol |
| Exact Mass | 852.21 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[2-(4-methoxy-2-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | COc1ccc(C(=CC2(C=C(c3ccc(N4CCCC4)cc3)c3ccc(OC)cc3C)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N3CCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C48H44Cl4N2O4/c1-29-25-35(56-3)17-19-37(29)39(31-9-13-33(14-10-31)53-21-5-6-22-53)27-48(42-41(47(55)58-48)43(49)45(51)46(52)44(42)50)28-40(38-20-18-36(57-4)26-30(38)2)32-11-15-34(16-12-32)54-23-7-8-24-54/h9-20,25-28H,5-8,21-24H2,1-4H3 |
| InChIKey | ZDXPGBCXKMXZDM-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.70 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|