C12H16Cl2O3S — CID 545425
(8,8-dichloro-6-tetracyclo[5.1.0.02,4.03,5]octanyl) 2-methylpropane-2-sulfonate (PubChem CID 545425) has the molecular formula C12H16Cl2O3S and a molecular weight of 311.23 g/mol. Its IUPAC name is (8,8-dichloro-6-tetracyclo[5.1.0.02,4.03,5]octanyl) 2-methylpropane-2-sulfonate.
| Compound Name | (8,8-dichloro-6-tetracyclo[5.1.0.02,4.03,5]octanyl) 2-methylpropane-2-sulfonate |
|---|---|
| PubChem CID | 545425 |
| Molecular Formula | C12H16Cl2O3S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (8,8-dichloro-6-tetracyclo[5.1.0.02,4.03,5]octanyl) 2-methylpropane-2-sulfonate |
| SMILES | CC(C)(C)S(=O)(=O)OC1C2C3C2C3C2C1C2(Cl)Cl |
| InChI | InChI=1S/C12H16Cl2O3S/c1-11(2,3)18(15,16)17-10-7-4-5(7)6(4)8-9(10)12(8,13)14/h4-10H,1-3H3 |
| InChIKey | CMFAOSDVKYPCLC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|