C24H20N4 — CID 54542789
25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-2,4,6(28),7,9,11,13(26),14,16,20,22-undecaene (PubChem CID 54542789) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-2,4,6(28),7,9,11,13(26),14,16,20,22-undecaene.
| Compound Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-2,4,6(28),7,9,11,13(26),14,16,20,22-undecaene |
|---|---|
| PubChem CID | 54542789 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-2,4,6(28),7,9,11,13(26),14,16,20,22-undecaene |
| SMILES | C1=CC2C3C=C4C=CC(=N4)C=c4ccc([nH]4)=CC4=NC(=CC(N3)C2C=C1)C=C4 |
| InChI | InChI=1S/C24H20N4/c1-2-4-22-21(3-1)23-13-19-9-7-17(26-19)11-15-5-6-16(25-15)12-18-8-10-20(27-18)14-24(22)28-23/h1-14,21-25,28H |
| InChIKey | DYIWNMYIQQHFLP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |