C31H33ClO2 — CID 54542871
2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 4-chloronaphthalene-2-carboxylate (PubChem CID 54542871) has the molecular formula C31H33ClO2 and a molecular weight of 473.06 g/mol. Its IUPAC name is 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 4-chloronaphthalene-2-carboxylate.
| Compound Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 4-chloronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54542871 |
| Molecular Formula | C31H33ClO2 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 4-chloronaphthalene-2-carboxylate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC=CC[C@@H]43)[C@@H]1CC[C@H]2C#COC(=O)c1cc(Cl)c2ccccc2c1 |
| InChI | InChI=1S/C31H33ClO2/c1-31-16-14-26-24-8-4-2-6-20(24)10-12-27(26)28(31)13-11-23(31)15-17-34-30(33)22-18-21-7-3-5-9-25(21)29(32)19-22/h2-5,7,9,18-20,23-24,26-28H,6,8,10-14,16H2,1H3/t20?,23-,24-,26+,27+,28-,31+/m0/s1 |
| InChIKey | ZEMJHNBAHYZMEC-YLTLAOGKSA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|