About 1-aminoheptan-3-one
1-aminoheptan-3-one (PubChem CID 54543281) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 1-aminoheptan-3-one.
Molecular Properties
| Compound Name | 1-aminoheptan-3-one |
| PubChem CID | 54543281 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1-aminoheptan-3-one |
| SMILES | CCCCC(=O)CCN |
| InChI | InChI=1S/C7H15NO/c1-2-3-4-7(9)5-6-8/h2-6,8H2,1H3 |
| InChIKey | ACSMPVVIZHGICK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-aminoheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoheptan-3-one?
The IUPAC name of 1-aminoheptan-3-one (CID 54543281) is 1-aminoheptan-3-one.
What is the SMILES notation for 1-aminoheptan-3-one?
The canonical SMILES for 1-aminoheptan-3-one is CCCCC(=O)CCN.
What is the InChIKey of 1-aminoheptan-3-one?
The InChIKey is ACSMPVVIZHGICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-2-3-4-7(9)5-6-8/h2-6,8H2,1H3.
What are the key properties of 1-aminoheptan-3-one?
1-aminoheptan-3-one has a molecular weight of 129.20 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoheptan-3-one is sourced from PubChem (CID 54543281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).