C40H37Br2N6+ — CID 54543514
5-bromo-3-[2-[1-[2-(5-bromo-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-5-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole (PubChem CID 54543514) has the molecular formula C40H37Br2N6+ and a molecular weight of 761.59 g/mol. Its IUPAC name is 5-bromo-3-[2-[1-[2-(5-bromo-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-5-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole.
| Compound Name | 5-bromo-3-[2-[1-[2-(5-bromo-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-5-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 54543514 |
| Molecular Formula | C40H37Br2N6+ |
| Molecular Weight | 761.59 g/mol |
| Exact Mass | 759.14 |
| IUPAC Name | 5-bromo-3-[2-[1-[2-(5-bromo-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-5-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole |
| SMILES | Brc1ccc2[nH]cc(CCC3C[N+](c4ccc5[nH]ccc5c4)(c4ccc5[nH]ccc5c4)CCN3CCc3c[nH]c4ccc(Br)cc34)c2c1 |
| InChI | InChI=1S/C40H37Br2N6/c41-30-2-7-39-35(21-30)28(23-45-39)1-4-32-25-48(33-5-9-37-26(19-33)11-14-43-37,34-6-10-38-27(20-34)12-15-44-38)18-17-47(32)16-13-29-24-46-40-8-3-31(42)22-36(29)40/h2-3,5-12,14-15,19-24,32,43-46H,1,4,13,16-18,25H2/q+1 |
| InChIKey | RJPCWWRBVVPJBK-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.59 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|