C28H47NO2 — CID 54543610
N-(3-hydroxypropyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide (PubChem CID 54543610) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide.
| Compound Name | N-(3-hydroxypropyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
|---|---|
| PubChem CID | 54543610 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | N-(3-hydroxypropyl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)NCCCO |
| InChI | InChI=1S/C28H47NO2/c1-23(2)12-7-13-24(3)14-8-15-25(4)16-9-17-26(5)18-10-19-27(6)22-28(31)29-20-11-21-30/h12,14,16,18,22,30H,7-11,13,15,17,19-21H2,1-6H3,(H,29,31) |
| InChIKey | ZEZJRAKMSZARIV-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|