C13H18O8S — CID 54543961
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-(4-methylphenyl)sulfonylhexan-1-one (PubChem CID 54543961) has the molecular formula C13H18O8S and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-(4-methylphenyl)sulfonylhexan-1-one.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-(4-methylphenyl)sulfonylhexan-1-one |
|---|---|
| PubChem CID | 54543961 |
| Molecular Formula | C13H18O8S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-(4-methylphenyl)sulfonylhexan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C13H18O8S/c1-7-2-4-8(5-3-7)22(20,21)13(19)12(18)11(17)10(16)9(15)6-14/h2-5,9-12,14-18H,6H2,1H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | ZFFYWQQOCYCYRX-WISYIIOYSA-N |
| XLogP | -2.27 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|