C27H44O4 — CID 54544112
5-[(3aS,4R,5R,6aR)-5-hydroxy-4-(3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-(2,6-dimethyl-4-propylcyclohexyl)pentanoic acid (PubChem CID 54544112) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aR)-5-hydroxy-4-(3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-(2,6-dimethyl-4-propylcyclohexyl)pentanoic acid.
| Compound Name | 5-[(3aS,4R,5R,6aR)-5-hydroxy-4-(3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-(2,6-dimethyl-4-propylcyclohexyl)pentanoic acid |
|---|---|
| PubChem CID | 54544112 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 5-[(3aS,4R,5R,6aR)-5-hydroxy-4-(3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-(2,6-dimethyl-4-propylcyclohexyl)pentanoic acid |
| SMILES | CCCC1CC(C)C(C(CCC=C2C[C@@H]3C[C@@H](O)[C@H](C=CCO)[C@H]3C2)C(=O)O)C(C)C1 |
| InChI | InChI=1S/C27H44O4/c1-4-7-19-12-17(2)26(18(3)13-19)23(27(30)31)9-5-8-20-14-21-16-25(29)22(10-6-11-28)24(21)15-20/h6,8,10,17-19,21-26,28-29H,4-5,7,9,11-16H2,1-3H3,(H,30,31)/t17?,18?,19?,21-,22-,23?,24+,25-,26?/m1/s1 |
| InChIKey | ZFIKQJPCELMZJG-OMJPEGNASA-N |
| XLogP | 5.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|