C9H14FN3O4 — CID 54544119
(1R)-1-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethanol (PubChem CID 54544119) has the molecular formula C9H14FN3O4 and a molecular weight of 247.23 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethanol |
|---|---|
| PubChem CID | 54544119 |
| Molecular Formula | C9H14FN3O4 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CN=[N+]=[N-])[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C9H14FN3O4/c1-9(2)16-7-5(10)6(15-8(7)17-9)4(14)3-12-13-11/h4-8,14H,3H2,1-2H3/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | ZFIMHOGAOMPSON-OZRXBMAMSA-N |
| XLogP | 0.87 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|