C25H32 — CID 54544142
1',1',3,3,4,5',6,6'-octamethyl-1,3'-spirobi[2H-indene] (PubChem CID 54544142) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1',1',3,3,4,5',6,6'-octamethyl-1,3'-spirobi[2H-indene].
| Compound Name | 1',1',3,3,4,5',6,6'-octamethyl-1,3'-spirobi[2H-indene] |
|---|---|
| PubChem CID | 54544142 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1',1',3,3,4,5',6,6'-octamethyl-1,3'-spirobi[2H-indene] |
| SMILES | Cc1cc(C)c2c(c1)C1(CC(C)(C)c3cc(C)c(C)cc31)CC2(C)C |
| InChI | InChI=1S/C25H32/c1-15-9-18(4)22-21(10-15)25(14-24(22,7)8)13-23(5,6)19-11-16(2)17(3)12-20(19)25/h9-12H,13-14H2,1-8H3 |
| InChIKey | ZFJARJLLORNENI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |