C27H27FN4O4 — CID 54544624
2-[3-(N-(5-fluoropyridine-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate (PubChem CID 54544624) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[3-(N-(5-fluoropyridine-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate.
| Compound Name | 2-[3-(N-(5-fluoropyridine-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 54544624 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[3-(N-(5-fluoropyridine-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| SMILES | O=C(CCN(C(=O)c1cncc(F)c1)c1ccccc1)NCCOC(=O)C1NCCc2ccccc21 |
| InChI | InChI=1S/C27H27FN4O4/c28-21-16-20(17-29-18-21)26(34)32(22-7-2-1-3-8-22)14-11-24(33)30-13-15-36-27(35)25-23-9-5-4-6-19(23)10-12-31-25/h1-9,16-18,25,31H,10-15H2,(H,30,33) |
| InChIKey | ZFQVJDYERPVMQQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|