About 2-(2-bromo-3,6-dimethylphenyl)acetonitrile
2-(2-bromo-3,6-dimethylphenyl)acetonitrile (PubChem CID 54544905) has the molecular formula C10H10BrN
and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-(2-bromo-3,6-dimethylphenyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(2-bromo-3,6-dimethylphenyl)acetonitrile |
| PubChem CID | 54544905 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-(2-bromo-3,6-dimethylphenyl)acetonitrile |
| SMILES | Cc1ccc(C)c(CC#N)c1Br |
| InChI | InChI=1S/C10H10BrN/c1-7-3-4-8(2)10(11)9(7)5-6-12/h3-4H,5H2,1-2H3 |
| InChIKey | ZFVJGCNVKGPGFW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-bromo-3,6-dimethylphenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-3,6-dimethylphenyl)acetonitrile?
The IUPAC name of 2-(2-bromo-3,6-dimethylphenyl)acetonitrile (CID 54544905) is 2-(2-bromo-3,6-dimethylphenyl)acetonitrile.
What is the SMILES notation for 2-(2-bromo-3,6-dimethylphenyl)acetonitrile?
The canonical SMILES for 2-(2-bromo-3,6-dimethylphenyl)acetonitrile is Cc1ccc(C)c(CC#N)c1Br.
What is the InChIKey of 2-(2-bromo-3,6-dimethylphenyl)acetonitrile?
The InChIKey is ZFVJGCNVKGPGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN/c1-7-3-4-8(2)10(11)9(7)5-6-12/h3-4H,5H2,1-2H3.
What are the key properties of 2-(2-bromo-3,6-dimethylphenyl)acetonitrile?
2-(2-bromo-3,6-dimethylphenyl)acetonitrile has a molecular weight of 224.10 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-3,6-dimethylphenyl)acetonitrile is sourced from PubChem (CID 54544905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).