About 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid
2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid (PubChem CID 54545046) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid |
| PubChem CID | 54545046 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1cc(O)[nH]c1O |
| InChI | InChI=1S/C6H8N2O4/c9-4-1-3(6(12)8-4)7-2-5(10)11/h1,7-9,12H,2H2,(H,10,11) |
| InChIKey | ZFXVUOFAAWORGX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid?
The IUPAC name of 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid (CID 54545046) is 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid.
What is the SMILES notation for 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid?
The canonical SMILES for 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid is O=C(O)CNc1cc(O)[nH]c1O.
What is the InChIKey of 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid?
The InChIKey is ZFXVUOFAAWORGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-4-1-3(6(12)8-4)7-2-5(10)11/h1,7-9,12H,2H2,(H,10,11).
What are the key properties of 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid?
2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid has a molecular weight of 172.14 g/mol, XLogP of -0.08, 3 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dihydroxy-1H-pyrrol-3-yl)amino]acetic acid is sourced from PubChem (CID 54545046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).