About 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene
2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene (PubChem CID 54545280) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene.
Molecular Properties
| Compound Name | 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene |
| PubChem CID | 54545280 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene |
| SMILES | C=CC12CC(C)CCC1C1C=CC2C1 |
| InChI | InChI=1S/C14H20/c1-3-14-9-10(2)4-7-13(14)11-5-6-12(14)8-11/h3,5-6,10-13H,1,4,7-9H2,2H3 |
| InChIKey | ZGCDDAMSCVAJAN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene?
The IUPAC name of 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene (CID 54545280) is 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene.
What is the SMILES notation for 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene?
The canonical SMILES for 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene is C=CC12CC(C)CCC1C1C=CC2C1.
What is the InChIKey of 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene?
The InChIKey is ZGCDDAMSCVAJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-3-14-9-10(2)4-7-13(14)11-5-6-12(14)8-11/h3,5-6,10-13H,1,4,7-9H2,2H3.
What are the key properties of 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene?
2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene has a molecular weight of 188.31 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-methyltricyclo[6.2.1.02,7]undec-9-ene is sourced from PubChem (CID 54545280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).