C26H44O4Si — CID 54545291
2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 54545291) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 54545291 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCC1=CCC(O)[C@@H]1CCC=C=CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C26H44O4Si/c1-7-13-20-17-18-23(27)22(20)16-9-8-12-19-26(24(28)29,21-14-10-11-15-21)30-31(5,6)25(2,3)4/h8,17,19,21-23,27H,7,9-11,13-16,18H2,1-6H3,(H,28,29)/t12?,22-,23?,26?/m1/s1 |
| InChIKey | ZGCIWTUJXOQDEM-PHCJYTDYSA-N |
| XLogP | 6.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|