About 4-amino-5-oxoheptanal
4-amino-5-oxoheptanal (PubChem CID 54545613) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-amino-5-oxoheptanal.
Molecular Properties
| Compound Name | 4-amino-5-oxoheptanal |
| PubChem CID | 54545613 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-amino-5-oxoheptanal |
| SMILES | CCC(=O)C(N)CCC=O |
| InChI | InChI=1S/C7H13NO2/c1-2-7(10)6(8)4-3-5-9/h5-6H,2-4,8H2,1H3 |
| InChIKey | ZGILRLBCJRQNMZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-oxoheptanal?
The IUPAC name of 4-amino-5-oxoheptanal (CID 54545613) is 4-amino-5-oxoheptanal.
What is the SMILES notation for 4-amino-5-oxoheptanal?
The canonical SMILES for 4-amino-5-oxoheptanal is CCC(=O)C(N)CCC=O.
What is the InChIKey of 4-amino-5-oxoheptanal?
The InChIKey is ZGILRLBCJRQNMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-7(10)6(8)4-3-5-9/h5-6H,2-4,8H2,1H3.
What are the key properties of 4-amino-5-oxoheptanal?
4-amino-5-oxoheptanal has a molecular weight of 143.19 g/mol, XLogP of 0.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-oxoheptanal is sourced from PubChem (CID 54545613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).