C7H9NO — CID 54546329
2-Methoxy-4-methylpenta-2,4-dienenitrile (PubChem CID 54546329) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 2-methoxy-4-methylpenta-2,4-dienenitrile.
| Compound Name | 2-Methoxy-4-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54546329 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2-methoxy-4-methylpenta-2,4-dienenitrile |
| SMILES | CC(=C)C=C(C#N)OC |
| InChI | InChI=1S/C7H9NO/c1-6(2)4-7(5-8)9-3/h4H,1H2,2-3H3 |
| InChIKey | ZGTUEIQLGQHQQC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 182 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|