About 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid
4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid (PubChem CID 54546561) has the molecular formula C25H22N2O4S
and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid |
| PubChem CID | 54546561 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid |
| SMILES | O=C(O)CC(Cc1ccccc1)(Cc1ccccc1)C(=O)OSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H22N2O4S/c28-22(29)17-25(15-18-9-3-1-4-10-18,16-19-11-5-2-6-12-19)23(30)31-32-24-26-20-13-7-8-14-21(20)27-24/h1-14H,15-17H2,(H,26,27)(H,28,29) |
| InChIKey | ZGXREROZGKENNH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid?
The IUPAC name of 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid (CID 54546561) is 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid?
The canonical SMILES for 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid is O=C(O)CC(Cc1ccccc1)(Cc1ccccc1)C(=O)OSc1nc2ccccc2[nH]1.
What is the InChIKey of 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid?
The InChIKey is ZGXREROZGKENNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O4S/c28-22(29)17-25(15-18-9-3-1-4-10-18,16-19-11-5-2-6-12-19)23(30)31-32-24-26-20-13-7-8-14-21(20)27-24/h1-14H,15-17H2,(H,26,27)(H,28,29).
What are the key properties of 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid?
4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid has a molecular weight of 446.53 g/mol, XLogP of 5.06, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-benzimidazol-2-ylsulfanyloxy)-3,3-dibenzyl-4-oxobutanoic acid is sourced from PubChem (CID 54546561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).