C12H26O2 — CID 54546631
4-hydroperoxy-2,2,3,3,5,5-hexamethylhexane (PubChem CID 54546631) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-hydroperoxy-2,2,3,3,5,5-hexamethylhexane.
| Compound Name | 4-hydroperoxy-2,2,3,3,5,5-hexamethylhexane |
|---|---|
| PubChem CID | 54546631 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 4-hydroperoxy-2,2,3,3,5,5-hexamethylhexane |
| SMILES | CC(C)(C)C(OO)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-10(2,3)9(14-13)12(7,8)11(4,5)6/h9,13H,1-8H3 |
| InChIKey | ZGYSRWJCUQZICP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|