1-butylcyclopropane-1-carbonyl chloride

C8H13ClO — CID 54546667

IUPAC1-butylcyclopropane-1-carbonyl chloride
SMILESCCCCC1(C(=O)Cl)CC1
InChIInChI=1S/C8H13ClO/c1-2-3-4-8(5-6-8)7(9)10/h2-6H2,1H3
InChIKeyZGZMOBICXRGVGS-UHFFFAOYSA-N
MW160.64 g/mol
LogP2.72
Rot. Bonds4

About 1-butylcyclopropane-1-carbonyl chloride

1-butylcyclopropane-1-carbonyl chloride (PubChem CID 54546667) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is 1-butylcyclopropane-1-carbonyl chloride.

Molecular Properties

Compound Name1-butylcyclopropane-1-carbonyl chloride
PubChem CID54546667
Molecular FormulaC8H13ClO
Molecular Weight160.64 g/mol
Exact Mass160.07
IUPAC Name1-butylcyclopropane-1-carbonyl chloride
SMILESCCCCC1(C(=O)Cl)CC1
InChIInChI=1S/C8H13ClO/c1-2-3-4-8(5-6-8)7(9)10/h2-6H2,1H3
InChIKeyZGZMOBICXRGVGS-UHFFFAOYSA-N
XLogP2.72
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.64
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-butylcyclopropane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butylcyclopropane-1-carbonyl chloride?
The IUPAC name of 1-butylcyclopropane-1-carbonyl chloride (CID 54546667) is 1-butylcyclopropane-1-carbonyl chloride.
What is the SMILES notation for 1-butylcyclopropane-1-carbonyl chloride?
The canonical SMILES for 1-butylcyclopropane-1-carbonyl chloride is CCCCC1(C(=O)Cl)CC1.
What is the InChIKey of 1-butylcyclopropane-1-carbonyl chloride?
The InChIKey is ZGZMOBICXRGVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO/c1-2-3-4-8(5-6-8)7(9)10/h2-6H2,1H3.
What are the key properties of 1-butylcyclopropane-1-carbonyl chloride?
1-butylcyclopropane-1-carbonyl chloride has a molecular weight of 160.64 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylcyclopropane-1-carbonyl chloride is sourced from PubChem (CID 54546667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).