About 3-amino-1,5-benzodiazepin-2-one
3-amino-1,5-benzodiazepin-2-one (PubChem CID 54546721) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-amino-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 3-amino-1,5-benzodiazepin-2-one |
| PubChem CID | 54546721 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-amino-1,5-benzodiazepin-2-one |
| SMILES | Nc1cnc2ccccc2nc1=O |
| InChI | InChI=1S/C9H7N3O/c10-6-5-11-7-3-1-2-4-8(7)12-9(6)13/h1-5H,(H2,10,12,13) |
| InChIKey | ZHALRINHFYUTDO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,5-benzodiazepin-2-one?
The IUPAC name of 3-amino-1,5-benzodiazepin-2-one (CID 54546721) is 3-amino-1,5-benzodiazepin-2-one.
What is the SMILES notation for 3-amino-1,5-benzodiazepin-2-one?
The canonical SMILES for 3-amino-1,5-benzodiazepin-2-one is Nc1cnc2ccccc2nc1=O.
What is the InChIKey of 3-amino-1,5-benzodiazepin-2-one?
The InChIKey is ZHALRINHFYUTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c10-6-5-11-7-3-1-2-4-8(7)12-9(6)13/h1-5H,(H2,10,12,13).
What are the key properties of 3-amino-1,5-benzodiazepin-2-one?
3-amino-1,5-benzodiazepin-2-one has a molecular weight of 173.17 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,5-benzodiazepin-2-one is sourced from PubChem (CID 54546721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).