C9H12O3 — CID 54546765
1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 54546765) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | 1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 54546765 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | O=C(O)C1COCC2CC=CC21 |
| InChI | InChI=1S/C9H12O3/c10-9(11)8-5-12-4-6-2-1-3-7(6)8/h1,3,6-8H,2,4-5H2,(H,10,11) |
| InChIKey | ZHBIIHDCTJRHIM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|