C22H23NO5 — CID 54546878
dimethyl 1-benzyl-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate (PubChem CID 54546878) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is dimethyl 1-benzyl-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 54546878 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | dimethyl 1-benzyl-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(CC(C)=O)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-15(24)11-17-9-10-19-18(12-17)13-22(20(25)27-2,21(26)28-3)23(19)14-16-7-5-4-6-8-16/h4-10,12H,11,13-14H2,1-3H3 |
| InChIKey | ZHDFMSJEMZEETF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|