C25H42F2O4 — CID 54547291
propyl 2-fluoro-7-[(1S,2R,5S)-2-fluoro-5-hydroxy-2-(3-hydroxyoctyl)cyclopentyl]-2-methyl-3-methylidenehept-5-enoate (PubChem CID 54547291) has the molecular formula C25H42F2O4 and a molecular weight of 444.60 g/mol. Its IUPAC name is propyl 2-fluoro-7-[(1S,2R,5S)-2-fluoro-5-hydroxy-2-(3-hydroxyoctyl)cyclopentyl]-2-methyl-3-methylidenehept-5-enoate.
| Compound Name | propyl 2-fluoro-7-[(1S,2R,5S)-2-fluoro-5-hydroxy-2-(3-hydroxyoctyl)cyclopentyl]-2-methyl-3-methylidenehept-5-enoate |
|---|---|
| PubChem CID | 54547291 |
| Molecular Formula | C25H42F2O4 |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | propyl 2-fluoro-7-[(1S,2R,5S)-2-fluoro-5-hydroxy-2-(3-hydroxyoctyl)cyclopentyl]-2-methyl-3-methylidenehept-5-enoate |
| SMILES | C=C(CC=CC[C@H]1[C@@H](O)CC[C@]1(F)CCC(O)CCCCC)C(C)(F)C(=O)OCCC |
| InChI | InChI=1S/C25H42F2O4/c1-5-7-8-12-20(28)14-16-25(27)17-15-22(29)21(25)13-10-9-11-19(3)24(4,26)23(30)31-18-6-2/h9-10,20-22,28-29H,3,5-8,11-18H2,1-2,4H3/t20?,21-,22-,24?,25+/m0/s1 |
| InChIKey | ZHKKLDAIEHNZGX-DZFYUVNBSA-N |
| XLogP | 5.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|