C39H78N6O12 — CID 54547524
2-N,2-N,4-N,4-N,6-N,6-N-hexakis[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 54547524) has the molecular formula C39H78N6O12 and a molecular weight of 823.08 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 54547524 |
| Molecular Formula | C39H78N6O12 |
| Molecular Weight | 823.08 g/mol |
| Exact Mass | 822.57 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[methoxy(2-methylpropoxy)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COC(OCC(C)C)N(c1nc(N(C(OC)OCC(C)C)C(OC)OCC(C)C)nc(N(C(OC)OCC(C)C)C(OC)OCC(C)C)n1)C(OC)OCC(C)C |
| InChI | InChI=1S/C39H78N6O12/c1-25(2)19-52-34(46-13)43(35(47-14)53-20-26(3)4)31-40-32(44(36(48-15)54-21-27(5)6)37(49-16)55-22-28(7)8)42-33(41-31)45(38(50-17)56-23-29(9)10)39(51-18)57-24-30(11)12/h25-30,34-39H,19-24H2,1-18H3 |
| InChIKey | ZHOMWDTZLFGEJX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 159.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.08 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|