About 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete
3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete (PubChem CID 54548388) has the molecular formula C10H16Cl2Si
and a molecular weight of 235.23 g/mol. Its IUPAC name is 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete.
Molecular Properties
| Compound Name | 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete |
| PubChem CID | 54548388 |
| Molecular Formula | C10H16Cl2Si |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete |
| SMILES | C/C=C(\C)C1=C(C)[Si](Cl)(Cl)C1CC |
| InChI | InChI=1S/C10H16Cl2Si/c1-5-7(3)10-8(4)13(11,12)9(10)6-2/h5,9H,6H2,1-4H3/b7-5+ |
| InChIKey | ZIEHBPFJIZUDRG-FNORWQNLSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete?
The IUPAC name of 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete (CID 54548388) is 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete.
What is the SMILES notation for 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete?
The canonical SMILES for 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete is C/C=C(\C)C1=C(C)[Si](Cl)(Cl)C1CC.
What is the InChIKey of 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete?
The InChIKey is ZIEHBPFJIZUDRG-FNORWQNLSA-N. The full InChI is InChI=1S/C10H16Cl2Si/c1-5-7(3)10-8(4)13(11,12)9(10)6-2/h5,9H,6H2,1-4H3/b7-5+.
What are the key properties of 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete?
3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete has a molecular weight of 235.23 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-2-en-2-yl]-1,1-dichloro-2-ethyl-4-methyl-2H-silete is sourced from PubChem (CID 54548388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).