2-chlorohexa-2,4-dienoic acid

C6H7ClO2 — CID 54548904

IUPAC2-chlorohexa-2,4-dienoic acid
SMILESCC=CC=C(Cl)C(=O)O
InChIInChI=1S/C6H7ClO2/c1-2-3-4-5(7)6(8)9/h2-4H,1H3,(H,8,9)
InChIKeyZINGPVGWKVTAAC-UHFFFAOYSA-N
MW146.57 g/mol
LogP1.77
Rot. Bonds2

About 2-chlorohexa-2,4-dienoic acid

2-chlorohexa-2,4-dienoic acid (PubChem CID 54548904) has the molecular formula C6H7ClO2 and a molecular weight of 146.57 g/mol. Its IUPAC name is 2-chlorohexa-2,4-dienoic acid.

Molecular Properties

Compound Name2-chlorohexa-2,4-dienoic acid
PubChem CID54548904
Molecular FormulaC6H7ClO2
Molecular Weight146.57 g/mol
Exact Mass146.01
IUPAC Name2-chlorohexa-2,4-dienoic acid
SMILESCC=CC=C(Cl)C(=O)O
InChIInChI=1S/C6H7ClO2/c1-2-3-4-5(7)6(8)9/h2-4H,1H3,(H,8,9)
InChIKeyZINGPVGWKVTAAC-UHFFFAOYSA-N
XLogP1.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.57
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-chlorohexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chlorohexa-2,4-dienoic acid?
The IUPAC name of 2-chlorohexa-2,4-dienoic acid (CID 54548904) is 2-chlorohexa-2,4-dienoic acid.
What is the SMILES notation for 2-chlorohexa-2,4-dienoic acid?
The canonical SMILES for 2-chlorohexa-2,4-dienoic acid is CC=CC=C(Cl)C(=O)O.
What is the InChIKey of 2-chlorohexa-2,4-dienoic acid?
The InChIKey is ZINGPVGWKVTAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO2/c1-2-3-4-5(7)6(8)9/h2-4H,1H3,(H,8,9).
What are the key properties of 2-chlorohexa-2,4-dienoic acid?
2-chlorohexa-2,4-dienoic acid has a molecular weight of 146.57 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorohexa-2,4-dienoic acid is sourced from PubChem (CID 54548904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).