C16H15NO — CID 54549872
(1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12,16-pentaen-14-one (PubChem CID 54549872) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12,16-pentaen-14-one.
| Compound Name | (1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12,16-pentaen-14-one |
|---|---|
| PubChem CID | 54549872 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12,16-pentaen-14-one |
| SMILES | O=C1C=CC[C@H]2[C@H]3Cc4ccccc4[C@@]12CC=N3 |
| InChI | InChI=1S/C16H15NO/c18-15-7-3-6-13-14-10-11-4-1-2-5-12(11)16(13,15)8-9-17-14/h1-5,7,9,13-14H,6,8,10H2/t13-,14+,16+/m0/s1 |
| InChIKey | ZJDUBQWSLKNPQD-SQWLQELKSA-N |
| XLogP | 2.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |