C23H22N2OS — CID 54549950
(10bR)-8-isoquinolin-4-ylsulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one (PubChem CID 54549950) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is (10bR)-8-isoquinolin-4-ylsulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (10bR)-8-isoquinolin-4-ylsulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54549950 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (10bR)-8-isoquinolin-4-ylsulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
| SMILES | C[C@]12CCC(=O)NC1CCc1cc(Sc3cncc4ccccc34)ccc12 |
| InChI | InChI=1S/C23H22N2OS/c1-23-11-10-22(26)25-21(23)9-6-15-12-17(7-8-19(15)23)27-20-14-24-13-16-4-2-3-5-18(16)20/h2-5,7-8,12-14,21H,6,9-11H2,1H3,(H,25,26)/t21?,23-/m1/s1 |
| InChIKey | ZJFAZJHIXMZFQO-JFGZAKSSSA-N |
| XLogP | 4.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |