C20H20N4OS — CID 5455002
N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5455002) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5455002 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1csc2c1CCCC2)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C20H20N4OS/c1-14(15-6-8-16(9-7-15)24-11-10-21-13-24)22-23-20(25)18-12-26-19-5-3-2-4-17(18)19/h6-13H,2-5H2,1H3,(H,23,25)/b22-14- |
| InChIKey | FIRPVSKREPKGEA-HMAPJEAMSA-N |
| XLogP | 3.97 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|