About 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one
2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one (PubChem CID 54550150) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one |
| PubChem CID | 54550150 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one |
| SMILES | CC=Cc1cccc2nc(OCC)oc(=O)c12 |
| InChI | InChI=1S/C13H13NO3/c1-3-6-9-7-5-8-10-11(9)12(15)17-13(14-10)16-4-2/h3,5-8H,4H2,1-2H3 |
| InChIKey | ZJICXJVSOKTMJJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one?
The IUPAC name of 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one (CID 54550150) is 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one?
The canonical SMILES for 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one is CC=Cc1cccc2nc(OCC)oc(=O)c12.
What is the InChIKey of 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one?
The InChIKey is ZJICXJVSOKTMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-3-6-9-7-5-8-10-11(9)12(15)17-13(14-10)16-4-2/h3,5-8H,4H2,1-2H3.
What are the key properties of 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one?
2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one has a molecular weight of 231.25 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-prop-1-enyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 54550150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).