About N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide
N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide (PubChem CID 54550623) has the molecular formula C20H17F2N3O
and a molecular weight of 353.37 g/mol. Its IUPAC name is N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide.
Molecular Properties
| Compound Name | N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide |
| PubChem CID | 54550623 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide |
| SMILES | NC(Cc1ccccc1)=Nc1ncccc1OCc1c(F)cccc1F |
| InChI | InChI=1S/C20H17F2N3O/c21-16-8-4-9-17(22)15(16)13-26-18-10-5-11-24-20(18)25-19(23)12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H2,23,24,25) |
| InChIKey | ZJQLQZBECKKAON-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide?
The IUPAC name of N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide (CID 54550623) is N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide.
What is the SMILES notation for N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide?
The canonical SMILES for N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide is NC(Cc1ccccc1)=Nc1ncccc1OCc1c(F)cccc1F.
What is the InChIKey of N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide?
The InChIKey is ZJQLQZBECKKAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O/c21-16-8-4-9-17(22)15(16)13-26-18-10-5-11-24-20(18)25-19(23)12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H2,23,24,25).
What are the key properties of N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide?
N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide has a molecular weight of 353.37 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[(2,6-difluorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide is sourced from PubChem (CID 54550623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).