C9H15N — CID 54550678
1,2,3,4,6,7,8,8a-octahydroisoquinoline (PubChem CID 54550678) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,8a-octahydroisoquinoline.
| Compound Name | 1,2,3,4,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 54550678 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1,2,3,4,6,7,8,8a-octahydroisoquinoline |
| SMILES | C1=C2CCNCC2CCC1 |
| InChI | InChI=1S/C9H15N/c1-2-4-9-7-10-6-5-8(9)3-1/h3,9-10H,1-2,4-7H2 |
| InChIKey | ZJRKGWQOMFCAME-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|