About 4-(cyclopropylmethyl)-1,4-dihydroquinazoline
4-(cyclopropylmethyl)-1,4-dihydroquinazoline (PubChem CID 54550725) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-(cyclopropylmethyl)-1,4-dihydroquinazoline |
| PubChem CID | 54550725 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-(cyclopropylmethyl)-1,4-dihydroquinazoline |
| SMILES | C1=NC(CC2CC2)c2ccccc2N1 |
| InChI | InChI=1S/C12H14N2/c1-2-4-11-10(3-1)12(14-8-13-11)7-9-5-6-9/h1-4,8-9,12H,5-7H2,(H,13,14) |
| InChIKey | ZJSFOAZRTUZQSX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(cyclopropylmethyl)-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopropylmethyl)-1,4-dihydroquinazoline?
The IUPAC name of 4-(cyclopropylmethyl)-1,4-dihydroquinazoline (CID 54550725) is 4-(cyclopropylmethyl)-1,4-dihydroquinazoline.
What is the SMILES notation for 4-(cyclopropylmethyl)-1,4-dihydroquinazoline?
The canonical SMILES for 4-(cyclopropylmethyl)-1,4-dihydroquinazoline is C1=NC(CC2CC2)c2ccccc2N1.
What is the InChIKey of 4-(cyclopropylmethyl)-1,4-dihydroquinazoline?
The InChIKey is ZJSFOAZRTUZQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-4-11-10(3-1)12(14-8-13-11)7-9-5-6-9/h1-4,8-9,12H,5-7H2,(H,13,14).
What are the key properties of 4-(cyclopropylmethyl)-1,4-dihydroquinazoline?
4-(cyclopropylmethyl)-1,4-dihydroquinazoline has a molecular weight of 186.26 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopropylmethyl)-1,4-dihydroquinazoline is sourced from PubChem (CID 54550725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).