C13H16O5 — CID 54550846
(3aS,4R,7aS)-4-(oxan-2-yloxy)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 54550846) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-(oxan-2-yloxy)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,4R,7aS)-4-(oxan-2-yloxy)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 54550846 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (3aS,4R,7aS)-4-(oxan-2-yloxy)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)[C@H]2CC=C[C@@H](OC3CCCCO3)[C@@H]12 |
| InChI | InChI=1S/C13H16O5/c14-12-8-4-3-5-9(11(8)13(15)18-12)17-10-6-1-2-7-16-10/h3,5,8-11H,1-2,4,6-7H2/t8-,9+,10?,11-/m0/s1 |
| InChIKey | ZJUJOWOVYYQSBY-IXMYILBSSA-N |
| XLogP | 1.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|