About methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate
methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate (PubChem CID 54551032) has the molecular formula C13H22O3
and a molecular weight of 226.31 g/mol. Its IUPAC name is methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate |
| PubChem CID | 54551032 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate |
| SMILES | C[C@]1([C@H](O1)C2CCCCC2)CCC(=O)OC |
| InChI | InChI=1S/C13H22O3/c1-13(9-8-11(14)15-2)12(16-13)10-6-4-3-5-7-10/h10,12H,3-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | ZJXWVUKGAQOBHR-CHWSQXEVSA-N |
| XLogP | 2.70 |
| TPSA | 38.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | 258 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate?
The IUPAC name of methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate (CID 54551032) is methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate.
What is the SMILES notation for methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate?
The canonical SMILES for methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate is C[C@]1([C@H](O1)C2CCCCC2)CCC(=O)OC.
What is the InChIKey of methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate?
The InChIKey is ZJXWVUKGAQOBHR-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H22O3/c1-13(9-8-11(14)15-2)12(16-13)10-6-4-3-5-7-10/h10,12H,3-9H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate?
methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate has a molecular weight of 226.31 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2R,3R)-3-cyclohexyl-2-methyloxiran-2-yl]propanoate is sourced from PubChem (CID 54551032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).