C12H19N — CID 54551469
3,4-diethyl-2,3,3a,7a-tetrahydro-1H-indole (PubChem CID 54551469) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3,4-diethyl-2,3,3a,7a-tetrahydro-1H-indole.
| Compound Name | 3,4-diethyl-2,3,3a,7a-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 54551469 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3,4-diethyl-2,3,3a,7a-tetrahydro-1H-indole |
| SMILES | CCC1=CC=CC2NCC(CC)C12 |
| InChI | InChI=1S/C12H19N/c1-3-9-6-5-7-11-12(9)10(4-2)8-13-11/h5-7,10-13H,3-4,8H2,1-2H3 |
| InChIKey | ZKESBKGKIMKFKD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |