C24H39FN2O3Si — CID 54551491
(2S)-2-acetamido-N-[5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enyl]-3-phenylpropanamide (PubChem CID 54551491) has the molecular formula C24H39FN2O3Si and a molecular weight of 450.67 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-acetamido-N-[5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54551491 |
| Molecular Formula | C24H39FN2O3Si |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | (2S)-2-acetamido-N-[5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enyl]-3-phenylpropanamide |
| SMILES | CCCC(C)(C)[Si](C)(C)OCCC=C(F)CNC(=O)[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C24H39FN2O3Si/c1-7-15-24(3,4)31(5,6)30-16-11-14-21(25)18-26-23(29)22(27-19(2)28)17-20-12-9-8-10-13-20/h8-10,12-14,22H,7,11,15-18H2,1-6H3,(H,26,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | ZKFBEDVMTMDOBU-QFIPXVFZSA-N |
| XLogP | 4.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|