C15H21NO2 — CID 54551566
9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 54551566) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 54551566 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 9-benzyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | c1ccc(CN2CCC3(CC2)OCCCO3)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-2-5-14(6-3-1)13-16-9-7-15(8-10-16)17-11-4-12-18-15/h1-3,5-6H,4,7-13H2 |
| InChIKey | ZKGKJSFHHJHLTP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |