About 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine
5,5-difluoro-3-hexylpent-2-ene-1,4-diamine (PubChem CID 54552133) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine |
| PubChem CID | 54552133 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine |
| SMILES | CCCCCCC(=CCN)C(N)C(F)F |
| InChI | InChI=1S/C11H22F2N2/c1-2-3-4-5-6-9(7-8-14)10(15)11(12)13/h7,10-11H,2-6,8,14-15H2,1H3 |
| InChIKey | ZKPXKNAFYROYJJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine?
The IUPAC name of 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine (CID 54552133) is 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine.
What is the SMILES notation for 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine?
The canonical SMILES for 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine is CCCCCCC(=CCN)C(N)C(F)F.
What is the InChIKey of 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine?
The InChIKey is ZKPXKNAFYROYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-2-3-4-5-6-9(7-8-14)10(15)11(12)13/h7,10-11H,2-6,8,14-15H2,1H3.
What are the key properties of 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine?
5,5-difluoro-3-hexylpent-2-ene-1,4-diamine has a molecular weight of 220.31 g/mol, XLogP of 2.43, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-3-hexylpent-2-ene-1,4-diamine is sourced from PubChem (CID 54552133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).