C21H23N3O4 — CID 5455229
N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 5455229) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 5455229 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc2c(c1)OCO2)c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-13(14-6-5-7-16(10-14)22-20(26)21(2,3)4)23-24-19(25)15-8-9-17-18(11-15)28-12-27-17/h5-11H,12H2,1-4H3,(H,22,26)(H,24,25)/b23-13- |
| InChIKey | ZLZPFRWRYBXRQC-QRVIBDJDSA-N |
| XLogP | 3.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|