C26H28N4O3S — CID 5455262
ethyl 2-[(4Z)-4-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5455262) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is ethyl 2-[(4Z)-4-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(4Z)-4-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5455262 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl 2-[(4Z)-4-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2N=C(C)/C(=C/c3cc(C)n(-c4cccc(C)c4C)c3C)C2=O)nc1C |
| InChI | InChI=1S/C26H28N4O3S/c1-8-33-25(32)23-18(6)27-26(34-23)30-24(31)21(17(5)28-30)13-20-12-15(3)29(19(20)7)22-11-9-10-14(2)16(22)4/h9-13H,8H2,1-7H3/b21-13- |
| InChIKey | WKMCNPONSRWODJ-BKUYFWCQSA-N |
| XLogP | 5.46 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|