About 4-hydroxy-1,3-oxazole-2-carboxylic acid
4-hydroxy-1,3-oxazole-2-carboxylic acid (PubChem CID 54552667) has the molecular formula C4H3NO4
and a molecular weight of 129.07 g/mol. Its IUPAC name is 4-hydroxy-1,3-oxazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-oxazole-2-carboxylic acid |
| PubChem CID | 54552667 |
| Molecular Formula | C4H3NO4 |
| Molecular Weight | 129.07 g/mol |
| Exact Mass | 129.01 |
| IUPAC Name | 4-hydroxy-1,3-oxazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(O)co1 |
| InChI | InChI=1S/C4H3NO4/c6-2-1-9-3(5-2)4(7)8/h1,6H,(H,7,8) |
| InChIKey | ZKZUAKRRMSBPLP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.07 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1,3-oxazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 4-hydroxy-1,3-oxazole-2-carboxylic acid (CID 54552667) is 4-hydroxy-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 4-hydroxy-1,3-oxazole-2-carboxylic acid is O=C(O)c1nc(O)co1.
What is the InChIKey of 4-hydroxy-1,3-oxazole-2-carboxylic acid?
The InChIKey is ZKZUAKRRMSBPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO4/c6-2-1-9-3(5-2)4(7)8/h1,6H,(H,7,8).
What are the key properties of 4-hydroxy-1,3-oxazole-2-carboxylic acid?
4-hydroxy-1,3-oxazole-2-carboxylic acid has a molecular weight of 129.07 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 54552667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).